Уролитин B (1139-83-9) Завод-изготовитель

Уролитин В

9 ноября 2020

Уролитин БСЕХНИЧЕСКИЕ

Имя: Уролитин В
Химическое название: 3-гидрокси-6H-дибензо [б, г] пиран-6-он
CAS: 1139-83-9
Химическая формула: C13H8O3
Молекулярная масса: X
Цвет:  Белый порошок
Ключ InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Код улыбки: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Функции: Уролитин B может улучшить функцию митохондрий и мышц.

Уролитин B может улучшить мышечную силу и выносливость при старении.

Спецификации: Уролитин B является кишечным микробным метаболитом эллагитанниса и проявляет мощную антиоксидантную и прооксидантную активность в зависимости от системы анализа и условий. Уролитин B может также проявлять эстрогенную и / или антиэстрогенную активность.
Растворимость: Легко растворим в N, N-диметилформамиде и диметилметилене. Сульфон, малорастворимый в метаноле, этаноле и этилацетате.
Температура хранения: Гигроскопичный, -20 ° C Морозильник, в инертной атмосфере
Условия доставки: Отгружается при температуре окружающей среды в качестве неопасного химиката. Этот продукт достаточно стабилен в течение нескольких недель при обычной доставке и времени, проведенном в таможне.